C17H25N3O2 — CID 110946890
ethyl 4-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]butanoate (PubChem CID 110946890) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is ethyl 4-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 110946890 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | ethyl 4-[[C-(3,4-dihydro-1H-isoquinolin-2-yl)-N-methylcarbonimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H25N3O2/c1-3-22-16(21)9-6-11-19-17(18-2)20-12-10-14-7-4-5-8-15(14)13-20/h4-5,7-8H,3,6,9-13H2,1-2H3,(H,18,19) |
| InChIKey | FQQFTBIJUWAASJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|