C21H32N4O2 — CID 111218301
ethyl 4-[[N-methyl-C-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]carbonimidoyl]amino]butanoate (PubChem CID 111218301) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is ethyl 4-[[N-methyl-C-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]carbonimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N-methyl-C-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]carbonimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111218301 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | ethyl 4-[[N-methyl-C-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]carbonimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N4O2/c1-3-27-20(26)12-7-13-23-21(22-2)25-17-15-24(16-18-25)14-8-11-19-9-5-4-6-10-19/h4-6,8-11H,3,7,12-18H2,1-2H3,(H,22,23)/b11-8+ |
| InChIKey | SUGWLJGTRURWFK-DHZHZOJOSA-N |
| XLogP | 2.24 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|