C19H32IN5O2S — CID 111218390
N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111218390) has the molecular formula C19H32IN5O2S and a molecular weight of 521.47 g/mol. Its IUPAC name is N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111218390 |
| Molecular Formula | C19H32IN5O2S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-[2-(ethylsulfonylamino)ethyl]-N'-methyl-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)N1CCN(CC=Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C19H31N5O2S.HI/c1-3-27(25,26)22-12-11-21-19(20-2)24-16-14-23(15-17-24)13-7-10-18-8-5-4-6-9-18;/h4-10,22H,3,11-17H2,1-2H3,(H,20,21);1H |
| InChIKey | SWLZJGRNDOTUDN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|