C22H31N5S — CID 111512696
N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide (PubChem CID 111512696) has the molecular formula C22H31N5S and a molecular weight of 397.59 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide.
| Compound Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111512696 |
| Molecular Formula | C22H31N5S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methyl-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
| SMILES | CCc1cnc(CCN/C(=N\C)N2CCN(C/C=C/c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C22H31N5S/c1-3-20-18-25-21(28-20)11-12-24-22(23-2)27-16-14-26(15-17-27)13-7-10-19-8-5-4-6-9-19/h4-10,18H,3,11-17H2,1-2H3,(H,23,24)/b10-7+ |
| InChIKey | BQFWBUUMVWVHDV-JXMROGBWSA-N |
| XLogP | 3.15 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|