C24H34N6 — CID 111218335
N'-methyl-4-[(E)-3-phenylprop-2-enyl]-N-[4-(pyridin-2-ylamino)butyl]piperazine-1-carboximidamide (PubChem CID 111218335) has the molecular formula C24H34N6 and a molecular weight of 406.58 g/mol. Its IUPAC name is N'-methyl-4-[(E)-3-phenylprop-2-enyl]-N-[4-(pyridin-2-ylamino)butyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-4-[(E)-3-phenylprop-2-enyl]-N-[4-(pyridin-2-ylamino)butyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218335 |
| Molecular Formula | C24H34N6 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | N'-methyl-4-[(E)-3-phenylprop-2-enyl]-N-[4-(pyridin-2-ylamino)butyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCNc1ccccn1)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H34N6/c1-25-24(28-16-8-7-15-27-23-13-5-6-14-26-23)30-20-18-29(19-21-30)17-9-12-22-10-3-2-4-11-22/h2-6,9-14H,7-8,15-21H2,1H3,(H,25,28)(H,26,27)/b12-9+ |
| InChIKey | FILUZXNTDFRTFS-FMIVXFBMSA-N |
| XLogP | 3.18 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|