C20H28N6O — CID 111218597
N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide (PubChem CID 111218597) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218597 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | N'-methyl-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-4-(3-phenylprop-2-enyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCc1nc(C)no1)N1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N6O/c1-17-23-19(27-24-17)10-11-22-20(21-2)26-15-13-25(14-16-26)12-6-9-18-7-4-3-5-8-18/h3-9H,10-16H2,1-2H3,(H,21,22) |
| InChIKey | WEBHXCIOGZYUSU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|