C16H28N4S — CID 111511006
N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide (PubChem CID 111511006) has the molecular formula C16H28N4S and a molecular weight of 308.50 g/mol. Its IUPAC name is N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide.
| Compound Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111511006 |
| Molecular Formula | C16H28N4S |
| Molecular Weight | 308.50 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N',3,5-trimethylpiperidine-1-carboximidamide |
| SMILES | CCc1cnc(CCN/C(=N\C)N2CC(C)CC(C)C2)s1 |
| InChI | InChI=1S/C16H28N4S/c1-5-14-9-19-15(21-14)6-7-18-16(17-4)20-10-12(2)8-13(3)11-20/h9,12-13H,5-8,10-11H2,1-4H3,(H,17,18) |
| InChIKey | RUTXHTRYCYWZDL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|