C22H35IN4O2 — CID 111218286
methyl 5-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]pentanoate;hydroiodide (PubChem CID 111218286) has the molecular formula C22H35IN4O2 and a molecular weight of 514.45 g/mol. Its IUPAC name is methyl 5-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111218286 |
| Molecular Formula | C22H35IN4O2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | methyl 5-[[ethylamino-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methylidene]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCC(=O)OC)N1CCN(C/C=C/c2ccccc2)CC1.I |
| InChI | InChI=1S/C22H34N4O2.HI/c1-3-23-22(24-14-8-7-13-21(27)28-2)26-18-16-25(17-19-26)15-9-12-20-10-5-4-6-11-20;/h4-6,9-12H,3,7-8,13-19H2,1-2H3,(H,23,24);1H/b12-9+; |
| InChIKey | PPMCZPYIHUDIPC-NBYYMMLRSA-N |
| XLogP | 3.24 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|