C22H37N5O2S — CID 111218569
N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide (PubChem CID 111218569) has the molecular formula C22H37N5O2S and a molecular weight of 435.64 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111218569 |
| Molecular Formula | C22H37N5O2S |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | N-ethyl-N'-[3-[ethyl(methylsulfonyl)amino]propyl]-4-[(E)-3-phenylprop-2-enyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)N1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C22H37N5O2S/c1-4-23-22(24-14-10-16-27(5-2)30(3,28)29)26-19-17-25(18-20-26)15-9-13-21-11-7-6-8-12-21/h6-9,11-13H,4-5,10,14-20H2,1-3H3,(H,23,24)/b13-9+ |
| InChIKey | VLRPUUBNOACXDF-UKTHLTGXSA-N |
| XLogP | 1.95 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|