C14H17NO3 — CID 46113477
methyl 5-(1,3-dihydroisoindol-2-yl)-5-oxopentanoate (PubChem CID 46113477) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is methyl 5-(1,3-dihydroisoindol-2-yl)-5-oxopentanoate.
| Compound Name | methyl 5-(1,3-dihydroisoindol-2-yl)-5-oxopentanoate |
|---|---|
| PubChem CID | 46113477 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | methyl 5-(1,3-dihydroisoindol-2-yl)-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H17NO3/c1-18-14(17)8-4-7-13(16)15-9-11-5-2-3-6-12(11)10-15/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | DRQLWJZIEFPVRL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |