C12H16N2O — CID 62230150
1-(1,3-dihydroisoindol-2-yl)-2-(ethylamino)ethanone (PubChem CID 62230150) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-(ethylamino)ethanone.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-(ethylamino)ethanone |
|---|---|
| PubChem CID | 62230150 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-(ethylamino)ethanone |
| SMILES | CCNCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H16N2O/c1-2-13-7-12(15)14-8-10-5-3-4-6-11(10)9-14/h3-6,13H,2,7-9H2,1H3 |
| InChIKey | WQTMVYLWXVFEAU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |