C16H15NO — CID 110472108
1-(1,3-dihydroisoindol-2-yl)-2-phenylethanone (PubChem CID 110472108) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-phenylethanone.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 110472108 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H15NO/c18-16(10-13-6-2-1-3-7-13)17-11-14-8-4-5-9-15(14)12-17/h1-9H,10-12H2 |
| InChIKey | YEKTUQPFJJWACR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |