C16H15NOS — CID 107028038
1-(1,3-dihydroisoindol-2-yl)-2-(4-sulfanylphenyl)ethanone (PubChem CID 107028038) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is 1-(1,3-dihydroisoindol-2-yl)-2-(4-sulfanylphenyl)ethanone.
| Compound Name | 1-(1,3-dihydroisoindol-2-yl)-2-(4-sulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 107028038 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 1-(1,3-dihydroisoindol-2-yl)-2-(4-sulfanylphenyl)ethanone |
| SMILES | O=C(Cc1ccc(S)cc1)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H15NOS/c18-16(9-12-5-7-15(19)8-6-12)17-10-13-3-1-2-4-14(13)11-17/h1-8,19H,9-11H2 |
| InChIKey | CZMRZYSRAZUVFF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|