C12H13NO2S — CID 166512227
S-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] ethanethioate (PubChem CID 166512227) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is S-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 166512227 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | S-[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H13NO2S/c1-9(14)16-8-12(15)13-6-10-4-2-3-5-11(10)7-13/h2-5H,6-8H2,1H3 |
| InChIKey | QGDWACFNGMCFOK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|