C11H10N2OS — CID 121006509
[2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] thiocyanate (PubChem CID 121006509) has the molecular formula C11H10N2OS and a molecular weight of 218.28 g/mol. Its IUPAC name is [2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] thiocyanate.
| Compound Name | [2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] thiocyanate |
|---|---|
| PubChem CID | 121006509 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | [2-(1,3-dihydroisoindol-2-yl)-2-oxoethyl] thiocyanate |
| SMILES | N#CSCC(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C11H10N2OS/c12-8-15-7-11(14)13-5-9-3-1-2-4-10(9)6-13/h1-4H,5-7H2 |
| InChIKey | KJRGRCTVSDAJIW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|