C15H21NO2 — CID 63152972
ethyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanoate (PubChem CID 63152972) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is ethyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanoate.
| Compound Name | ethyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanoate |
|---|---|
| PubChem CID | 63152972 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethyl 3-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)propanoate |
| SMILES | CCOC(=O)CCN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C15H21NO2/c1-2-18-15(17)9-11-16-10-5-8-13-6-3-4-7-14(13)12-16/h3-4,6-7H,2,5,8-12H2,1H3 |
| InChIKey | DBFRHQIOIISNLX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |