C12H17N3O — CID 63573779
2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetohydrazide (PubChem CID 63573779) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetohydrazide.
| Compound Name | 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 63573779 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetohydrazide |
| SMILES | NNC(=O)CN1CCCc2ccccc2C1 |
| InChI | InChI=1S/C12H17N3O/c13-14-12(16)9-15-7-3-6-10-4-1-2-5-11(10)8-15/h1-2,4-5H,3,6-9,13H2,(H,14,16) |
| InChIKey | CJPQQRAZFUBALI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|