2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid

C12H15NO2 — CID 54461030

IUPAC2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid
SMILESO=C(O)CN1CCCc2ccccc2C1
InChIInChI=1S/C12H15NO2/c14-12(15)9-13-7-3-6-10-4-1-2-5-11(10)8-13/h1-2,4-5H,3,6-9H2,(H,14,15)
InChIKeyXBQCJSMXXZAQSR-UHFFFAOYSA-N
MW205.26 g/mol
LogP1.52
Rot. Bonds2

About 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid

2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid (PubChem CID 54461030) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid
PubChem CID54461030
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid
SMILESO=C(O)CN1CCCc2ccccc2C1
InChIInChI=1S/C12H15NO2/c14-12(15)9-13-7-3-6-10-4-1-2-5-11(10)8-13/h1-2,4-5H,3,6-9H2,(H,14,15)
InChIKeyXBQCJSMXXZAQSR-UHFFFAOYSA-N
XLogP1.52
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid?
The IUPAC name of 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid (CID 54461030) is 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid.
What is the SMILES notation for 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid?
The canonical SMILES for 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid is O=C(O)CN1CCCc2ccccc2C1.
What is the InChIKey of 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid?
The InChIKey is XBQCJSMXXZAQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-12(15)9-13-7-3-6-10-4-1-2-5-11(10)8-13/h1-2,4-5H,3,6-9H2,(H,14,15).
What are the key properties of 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid?
2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid has a molecular weight of 205.26 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)acetic acid is sourced from PubChem (CID 54461030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).