C17H21Cl2N — CID 142634815
2-benzyl-1,3,4,5-tetrahydro-2-benzazepine;dihydrochloride (PubChem CID 142634815) has the molecular formula C17H21Cl2N and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-benzyl-1,3,4,5-tetrahydro-2-benzazepine;dihydrochloride.
| Compound Name | 2-benzyl-1,3,4,5-tetrahydro-2-benzazepine;dihydrochloride |
|---|---|
| PubChem CID | 142634815 |
| Molecular Formula | C17H21Cl2N |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-benzyl-1,3,4,5-tetrahydro-2-benzazepine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(CN2CCCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H19N.2ClH/c1-2-7-15(8-3-1)13-18-12-6-11-16-9-4-5-10-17(16)14-18;;/h1-5,7-10H,6,11-14H2;2*1H |
| InChIKey | XKMCXVRFRHTVQQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |