About 1-benzylpiperidin-3-one;ethene
1-benzylpiperidin-3-one;ethene (PubChem CID 153347429) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-benzylpiperidin-3-one;ethene.
Molecular Properties
| Compound Name | 1-benzylpiperidin-3-one;ethene |
| PubChem CID | 153347429 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-benzylpiperidin-3-one;ethene |
| SMILES | C=C.O=C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO.C2H4/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;1-2/h1-3,5-6H,4,7-10H2;1-2H2 |
| InChIKey | SEPNOIVIMREHNW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylpiperidin-3-one;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidin-3-one;ethene?
The IUPAC name of 1-benzylpiperidin-3-one;ethene (CID 153347429) is 1-benzylpiperidin-3-one;ethene.
What is the SMILES notation for 1-benzylpiperidin-3-one;ethene?
The canonical SMILES for 1-benzylpiperidin-3-one;ethene is C=C.O=C1CCCN(Cc2ccccc2)C1.
What is the InChIKey of 1-benzylpiperidin-3-one;ethene?
The InChIKey is SEPNOIVIMREHNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.C2H4/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;1-2/h1-3,5-6H,4,7-10H2;1-2H2.
What are the key properties of 1-benzylpiperidin-3-one;ethene?
1-benzylpiperidin-3-one;ethene has a molecular weight of 217.31 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidin-3-one;ethene is sourced from PubChem (CID 153347429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).