About 1-benzylpiperidin-3-one;hydrate
1-benzylpiperidin-3-one;hydrate (PubChem CID 144851326) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-benzylpiperidin-3-one;hydrate.
Molecular Properties
| Compound Name | 1-benzylpiperidin-3-one;hydrate |
| PubChem CID | 144851326 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-benzylpiperidin-3-one;hydrate |
| SMILES | O.O=C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO.H2O/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10H2;1H2 |
| InChIKey | HHBUJIOBECBVHY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylpiperidin-3-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidin-3-one;hydrate?
The IUPAC name of 1-benzylpiperidin-3-one;hydrate (CID 144851326) is 1-benzylpiperidin-3-one;hydrate.
What is the SMILES notation for 1-benzylpiperidin-3-one;hydrate?
The canonical SMILES for 1-benzylpiperidin-3-one;hydrate is O.O=C1CCCN(Cc2ccccc2)C1.
What is the InChIKey of 1-benzylpiperidin-3-one;hydrate?
The InChIKey is HHBUJIOBECBVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.H2O/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10H2;1H2.
What are the key properties of 1-benzylpiperidin-3-one;hydrate?
1-benzylpiperidin-3-one;hydrate has a molecular weight of 207.27 g/mol, XLogP of 1.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidin-3-one;hydrate is sourced from PubChem (CID 144851326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).