C17H18BrN — CID 63457850
2-[(4-bromophenyl)methyl]-1,3,4,5-tetrahydro-2-benzazepine (PubChem CID 63457850) has the molecular formula C17H18BrN and a molecular weight of 316.24 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1,3,4,5-tetrahydro-2-benzazepine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1,3,4,5-tetrahydro-2-benzazepine |
|---|---|
| PubChem CID | 63457850 |
| Molecular Formula | C17H18BrN |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1,3,4,5-tetrahydro-2-benzazepine |
| SMILES | Brc1ccc(CN2CCCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C17H18BrN/c18-17-9-7-14(8-10-17)12-19-11-3-6-15-4-1-2-5-16(15)13-19/h1-2,4-5,7-10H,3,6,11-13H2 |
| InChIKey | NTZOVIGRNQWVSH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |