About 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine
1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine (PubChem CID 174819017) has the molecular formula C19H25BrN2
and a molecular weight of 361.33 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine.
Molecular Properties
| Compound Name | 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine |
| PubChem CID | 174819017 |
| Molecular Formula | C19H25BrN2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine |
| SMILES | Brc1ccc(CN2CCCCC2)cc1.NCc1ccccc1 |
| InChI | InChI=1S/C12H16BrN.C7H9N/c13-12-6-4-11(5-7-12)10-14-8-2-1-3-9-14;8-6-7-4-2-1-3-5-7/h4-7H,1-3,8-10H2;1-5H,6,8H2 |
| InChIKey | QLMBFKFTDQUKSS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine?
The IUPAC name of 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine (CID 174819017) is 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine.
What is the SMILES notation for 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine?
The canonical SMILES for 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine is Brc1ccc(CN2CCCCC2)cc1.NCc1ccccc1.
What is the InChIKey of 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine?
The InChIKey is QLMBFKFTDQUKSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrN.C7H9N/c13-12-6-4-11(5-7-12)10-14-8-2-1-3-9-14;8-6-7-4-2-1-3-5-7/h4-7H,1-3,8-10H2;1-5H,6,8H2.
What are the key properties of 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine?
1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine has a molecular weight of 361.33 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-bromophenyl)methyl]piperidine;phenylmethanamine is sourced from PubChem (CID 174819017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).