C26H32N2 — CID 123620397
N-benzyl-1-phenylmethanamine;1-benzylpiperidine (PubChem CID 123620397) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;1-benzylpiperidine.
| Compound Name | N-benzyl-1-phenylmethanamine;1-benzylpiperidine |
|---|---|
| PubChem CID | 123620397 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;1-benzylpiperidine |
| SMILES | c1ccc(CN2CCCCC2)cc1.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.C12H17N/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13/h1-10,15H,11-12H2;1,3-4,7-8H,2,5-6,9-11H2 |
| InChIKey | CDIGUSLZQAUXPF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |