C19H25N3 — CID 83962786
1-[4-(piperidin-1-ylmethyl)phenyl]-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 83962786) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-[4-(piperidin-1-ylmethyl)phenyl]-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-[4-(piperidin-1-ylmethyl)phenyl]-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 83962786 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 1-[4-(piperidin-1-ylmethyl)phenyl]-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | c1ccc(CNCc2ccc(CN3CCCCC3)cc2)nc1 |
| InChI | InChI=1S/C19H25N3/c1-4-12-22(13-5-1)16-18-9-7-17(8-10-18)14-20-15-19-6-2-3-11-21-19/h2-3,6-11,20H,1,4-5,12-16H2 |
| InChIKey | KCAATVXAFFHKQK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |