C27H36N6 — CID 45486368
N-(pyridin-2-ylmethyl)-1-[4-(4,7,10,15-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-ylmethyl)phenyl]methanamine (PubChem CID 45486368) has the molecular formula C27H36N6 and a molecular weight of 444.63 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1-[4-(4,7,10,15-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-ylmethyl)phenyl]methanamine.
| Compound Name | N-(pyridin-2-ylmethyl)-1-[4-(4,7,10,15-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-ylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 45486368 |
| Molecular Formula | C27H36N6 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1-[4-(4,7,10,15-tetrazabicyclo[11.3.1]heptadeca-1(17),13,15-trien-7-ylmethyl)phenyl]methanamine |
| SMILES | c1ccc(CNCc2ccc(CN3CCNCCc4cncc(c4)CCNCC3)cc2)nc1 |
| InChI | InChI=1S/C27H36N6/c1-2-10-32-27(3-1)21-31-18-23-4-6-24(7-5-23)22-33-15-13-28-11-8-25-17-26(20-30-19-25)9-12-29-14-16-33/h1-7,10,17,19-20,28-29,31H,8-9,11-16,18,21-22H2 |
| InChIKey | PFSXVKFIGWIZFZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |