About methanamine;1-(pyridin-2-ylmethyl)piperazine
methanamine;1-(pyridin-2-ylmethyl)piperazine (PubChem CID 142253020) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is methanamine;1-(pyridin-2-ylmethyl)piperazine.
Molecular Properties
| Compound Name | methanamine;1-(pyridin-2-ylmethyl)piperazine |
| PubChem CID | 142253020 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | methanamine;1-(pyridin-2-ylmethyl)piperazine |
| SMILES | CN.c1ccc(CN2CCNCC2)nc1 |
| InChI | InChI=1S/C10H15N3.CH5N/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13;1-2/h1-4,11H,5-9H2;2H2,1H3 |
| InChIKey | LNOJZLIATVDHCS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanamine;1-(pyridin-2-ylmethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-(pyridin-2-ylmethyl)piperazine?
The IUPAC name of methanamine;1-(pyridin-2-ylmethyl)piperazine (CID 142253020) is methanamine;1-(pyridin-2-ylmethyl)piperazine.
What is the SMILES notation for methanamine;1-(pyridin-2-ylmethyl)piperazine?
The canonical SMILES for methanamine;1-(pyridin-2-ylmethyl)piperazine is CN.c1ccc(CN2CCNCC2)nc1.
What is the InChIKey of methanamine;1-(pyridin-2-ylmethyl)piperazine?
The InChIKey is LNOJZLIATVDHCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3.CH5N/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13;1-2/h1-4,11H,5-9H2;2H2,1H3.
What are the key properties of methanamine;1-(pyridin-2-ylmethyl)piperazine?
methanamine;1-(pyridin-2-ylmethyl)piperazine has a molecular weight of 208.31 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-(pyridin-2-ylmethyl)piperazine is sourced from PubChem (CID 142253020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).