About piperazine;1-(pyridin-2-ylmethyl)piperazine
piperazine;1-(pyridin-2-ylmethyl)piperazine (PubChem CID 174820345) has the molecular formula C14H25N5
and a molecular weight of 263.39 g/mol. Its IUPAC name is piperazine;1-(pyridin-2-ylmethyl)piperazine.
Molecular Properties
| Compound Name | piperazine;1-(pyridin-2-ylmethyl)piperazine |
| PubChem CID | 174820345 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | piperazine;1-(pyridin-2-ylmethyl)piperazine |
| SMILES | C1CNCCN1.c1ccc(CN2CCNCC2)nc1 |
| InChI | InChI=1S/C10H15N3.C4H10N2/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13;1-2-6-4-3-5-1/h1-4,11H,5-9H2;5-6H,1-4H2 |
| InChIKey | GEWJDNPOVPKUOO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze piperazine;1-(pyridin-2-ylmethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine;1-(pyridin-2-ylmethyl)piperazine?
The IUPAC name of piperazine;1-(pyridin-2-ylmethyl)piperazine (CID 174820345) is piperazine;1-(pyridin-2-ylmethyl)piperazine.
What is the SMILES notation for piperazine;1-(pyridin-2-ylmethyl)piperazine?
The canonical SMILES for piperazine;1-(pyridin-2-ylmethyl)piperazine is C1CNCCN1.c1ccc(CN2CCNCC2)nc1.
What is the InChIKey of piperazine;1-(pyridin-2-ylmethyl)piperazine?
The InChIKey is GEWJDNPOVPKUOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3.C4H10N2/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13;1-2-6-4-3-5-1/h1-4,11H,5-9H2;5-6H,1-4H2.
What are the key properties of piperazine;1-(pyridin-2-ylmethyl)piperazine?
piperazine;1-(pyridin-2-ylmethyl)piperazine has a molecular weight of 263.39 g/mol, XLogP of -0.33, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine;1-(pyridin-2-ylmethyl)piperazine is sourced from PubChem (CID 174820345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).