C16H31N5 — CID 171786933
ethane;1-(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane (PubChem CID 171786933) has the molecular formula C16H31N5 and a molecular weight of 293.46 g/mol. Its IUPAC name is ethane;1-(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane.
| Compound Name | ethane;1-(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
|---|---|
| PubChem CID | 171786933 |
| Molecular Formula | C16H31N5 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | ethane;1-(pyridin-2-ylmethyl)-1,4,7,10-tetrazacyclododecane |
| SMILES | CC.c1ccc(CN2CCNCCNCCNCC2)nc1 |
| InChI | InChI=1S/C14H25N5.C2H6/c1-2-4-18-14(3-1)13-19-11-9-16-7-5-15-6-8-17-10-12-19;1-2/h1-4,15-17H,5-13H2;1-2H3 |
| InChIKey | LZFIKTFVZVIISF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |