C14H23N3S2 — CID 102482924
4-(pyridin-2-ylmethyl)-1,7-dithia-4,10-diazacyclododecane (PubChem CID 102482924) has the molecular formula C14H23N3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethyl)-1,7-dithia-4,10-diazacyclododecane.
| Compound Name | 4-(pyridin-2-ylmethyl)-1,7-dithia-4,10-diazacyclododecane |
|---|---|
| PubChem CID | 102482924 |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-(pyridin-2-ylmethyl)-1,7-dithia-4,10-diazacyclododecane |
| SMILES | c1ccc(CN2CCSCCNCCSCC2)nc1 |
| InChI | InChI=1S/C14H23N3S2/c1-2-4-16-14(3-1)13-17-7-11-18-9-5-15-6-10-19-12-8-17/h1-4,15H,5-13H2 |
| InChIKey | XGHWUSDTDXEXDS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |