C12H16F3N3 — CID 171700809
1-(pyridin-2-ylmethyl)-4-(2,2,2-trifluoroethyl)piperazine (PubChem CID 171700809) has the molecular formula C12H16F3N3 and a molecular weight of 259.27 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)-4-(2,2,2-trifluoroethyl)piperazine.
| Compound Name | 1-(pyridin-2-ylmethyl)-4-(2,2,2-trifluoroethyl)piperazine |
|---|---|
| PubChem CID | 171700809 |
| Molecular Formula | C12H16F3N3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)-4-(2,2,2-trifluoroethyl)piperazine |
| SMILES | FC(F)(F)CN1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C12H16F3N3/c13-12(14,15)10-18-7-5-17(6-8-18)9-11-3-1-2-4-16-11/h1-4H,5-10H2 |
| InChIKey | CLETZKNSBTUKFR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |