C14H17F6N3O4 — CID 22648051
1-(pyridin-2-ylmethyl)piperazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 22648051) has the molecular formula C14H17F6N3O4 and a molecular weight of 405.30 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)piperazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(pyridin-2-ylmethyl)piperazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 22648051 |
| Molecular Formula | C14H17F6N3O4 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)piperazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CN2CCNCC2)nc1 |
| InChI | InChI=1S/C10H15N3.2C2HF3O2/c1-2-4-12-10(3-1)9-13-7-5-11-6-8-13;2*3-2(4,5)1(6)7/h1-4,11H,5-9H2;2*(H,6,7) |
| InChIKey | WBSRNALBUWEJJF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |