C15H27N5 — CID 158212763
azane;methane;[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methanamine (PubChem CID 158212763) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is azane;methane;[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methanamine.
| Compound Name | azane;methane;[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 158212763 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | azane;methane;[4-[(pyridin-2-ylmethylamino)methyl]phenyl]methanamine |
| SMILES | C.N.N.NCc1ccc(CNCc2ccccn2)cc1 |
| InChI | InChI=1S/C14H17N3.CH4.2H3N/c15-9-12-4-6-13(7-5-12)10-16-11-14-3-1-2-8-17-14;;;/h1-8,16H,9-11,15H2;1H4;2*1H3 |
| InChIKey | BMQSVZCTYIPSNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |