C17H23N3 — CID 834543
N,N-diethyl-4-[(pyridin-2-ylmethylamino)methyl]aniline (PubChem CID 834543) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is N,N-diethyl-4-[(pyridin-2-ylmethylamino)methyl]aniline.
| Compound Name | N,N-diethyl-4-[(pyridin-2-ylmethylamino)methyl]aniline |
|---|---|
| PubChem CID | 834543 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | N,N-diethyl-4-[(pyridin-2-ylmethylamino)methyl]aniline |
| SMILES | CCN(CC)c1ccc(CNCc2ccccn2)cc1 |
| InChI | InChI=1S/C17H23N3/c1-3-20(4-2)17-10-8-15(9-11-17)13-18-14-16-7-5-6-12-19-16/h5-12,18H,3-4,13-14H2,1-2H3 |
| InChIKey | PCAUFANHGBQDDJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|