C18H26N4 — CID 119111673
1-[4-(azepan-1-ylmethyl)phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine (PubChem CID 119111673) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[4-(azepan-1-ylmethyl)phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine.
| Compound Name | 1-[4-(azepan-1-ylmethyl)phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 119111673 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-[4-(azepan-1-ylmethyl)phenyl]-N-(1H-imidazol-2-ylmethyl)methanamine |
| SMILES | c1c[nH]c(CNCc2ccc(CN3CCCCCC3)cc2)n1 |
| InChI | InChI=1S/C18H26N4/c1-2-4-12-22(11-3-1)15-17-7-5-16(6-8-17)13-19-14-18-20-9-10-21-18/h5-10,19H,1-4,11-15H2,(H,20,21) |
| InChIKey | BXKOVIYJPWVZTL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |