C19H24N2 — CID 16793650
[2-[4-(piperidin-1-ylmethyl)phenyl]phenyl]methanamine (PubChem CID 16793650) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is [2-[4-(piperidin-1-ylmethyl)phenyl]phenyl]methanamine.
| Compound Name | [2-[4-(piperidin-1-ylmethyl)phenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 16793650 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [2-[4-(piperidin-1-ylmethyl)phenyl]phenyl]methanamine |
| SMILES | NCc1ccccc1-c1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C19H24N2/c20-14-18-6-2-3-7-19(18)17-10-8-16(9-11-17)15-21-12-4-1-5-13-21/h2-3,6-11H,1,4-5,12-15,20H2 |
| InChIKey | AWZIQESSHIPBAF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |