C22H22ClN — CID 45263090
2-benzyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrochloride (PubChem CID 45263090) has the molecular formula C22H22ClN and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-benzyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrochloride.
| Compound Name | 2-benzyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrochloride |
|---|---|
| PubChem CID | 45263090 |
| Molecular Formula | C22H22ClN |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-benzyl-8-phenyl-3,4-dihydro-1H-isoquinoline;hydrochloride |
| SMILES | Cl.c1ccc(CN2CCc3cccc(-c4ccccc4)c3C2)cc1 |
| InChI | InChI=1S/C22H21N.ClH/c1-3-8-18(9-4-1)16-23-15-14-20-12-7-13-21(22(20)17-23)19-10-5-2-6-11-19;/h1-13H,14-17H2;1H |
| InChIKey | PTQLFCVMYMCDGV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |