C20H27N — CID 145118805
2-benzyl-6-ethyl-3,4-dihydro-1H-isoquinoline;ethane (PubChem CID 145118805) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-benzyl-6-ethyl-3,4-dihydro-1H-isoquinoline;ethane.
| Compound Name | 2-benzyl-6-ethyl-3,4-dihydro-1H-isoquinoline;ethane |
|---|---|
| PubChem CID | 145118805 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-benzyl-6-ethyl-3,4-dihydro-1H-isoquinoline;ethane |
| SMILES | CC.CCc1ccc2c(c1)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C18H21N.C2H6/c1-2-15-8-9-18-14-19(11-10-17(18)12-15)13-16-6-4-3-5-7-16;1-2/h3-9,12H,2,10-11,13-14H2,1H3;1-2H3 |
| InChIKey | CDVKLSGPOQCFAR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |