C16H19ClN2 — CID 23298431
2-benzyl-3,4-dihydro-1H-isoquinolin-7-amine;hydrochloride (PubChem CID 23298431) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 2-benzyl-3,4-dihydro-1H-isoquinolin-7-amine;hydrochloride.
| Compound Name | 2-benzyl-3,4-dihydro-1H-isoquinolin-7-amine;hydrochloride |
|---|---|
| PubChem CID | 23298431 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-benzyl-3,4-dihydro-1H-isoquinolin-7-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H18N2.ClH/c17-16-7-6-14-8-9-18(12-15(14)10-16)11-13-4-2-1-3-5-13;/h1-7,10H,8-9,11-12,17H2;1H |
| InChIKey | LHBLZKYNEWCOJX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|