C14H16N2S — CID 57425284
6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-amine (PubChem CID 57425284) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-amine.
| Compound Name | 6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-amine |
|---|---|
| PubChem CID | 57425284 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 6-benzyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-amine |
| SMILES | Nc1cc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C14H16N2S/c15-14-8-12-6-7-16(10-13(12)17-14)9-11-4-2-1-3-5-11/h1-5,8H,6-7,9-10,15H2 |
| InChIKey | KVQNKTPLGYZENO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |