C16H15Cl2N — CID 90487760
2-benzyl-5,7-dichloro-3,4-dihydro-1H-isoquinoline (PubChem CID 90487760) has the molecular formula C16H15Cl2N and a molecular weight of 292.21 g/mol. Its IUPAC name is 2-benzyl-5,7-dichloro-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-benzyl-5,7-dichloro-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 90487760 |
| Molecular Formula | C16H15Cl2N |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-benzyl-5,7-dichloro-3,4-dihydro-1H-isoquinoline |
| SMILES | Clc1cc(Cl)c2c(c1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H15Cl2N/c17-14-8-13-11-19(7-6-15(13)16(18)9-14)10-12-4-2-1-3-5-12/h1-5,8-9H,6-7,10-11H2 |
| InChIKey | MGJCWOXJCJTCOV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |