About 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine
1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine (PubChem CID 139357568) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine.
Molecular Properties
| Compound Name | 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine |
| PubChem CID | 139357568 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine |
| SMILES | CC1=C(N)CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H18N2/c1-11-7-8-15(10-13(11)14)9-12-5-3-2-4-6-12/h2-6H,7-10,14H2,1H3 |
| InChIKey | RWJPRXMIVAQGDN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine?
The IUPAC name of 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine (CID 139357568) is 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine.
What is the SMILES notation for 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine?
The canonical SMILES for 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine is CC1=C(N)CN(Cc2ccccc2)CC1.
What is the InChIKey of 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine?
The InChIKey is RWJPRXMIVAQGDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-11-7-8-15(10-13(11)14)9-12-5-3-2-4-6-12/h2-6H,7-10,14H2,1H3.
What are the key properties of 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine?
1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine has a molecular weight of 202.30 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methyl-3,6-dihydro-2H-pyridin-5-amine is sourced from PubChem (CID 139357568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).