C17H23NO2 — CID 10707422
ethyl 2-(1-benzyl-5-methyl-3,6-dihydro-2H-pyridin-4-yl)acetate (PubChem CID 10707422) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is ethyl 2-(1-benzyl-5-methyl-3,6-dihydro-2H-pyridin-4-yl)acetate.
| Compound Name | ethyl 2-(1-benzyl-5-methyl-3,6-dihydro-2H-pyridin-4-yl)acetate |
|---|---|
| PubChem CID | 10707422 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | ethyl 2-(1-benzyl-5-methyl-3,6-dihydro-2H-pyridin-4-yl)acetate |
| SMILES | CCOC(=O)CC1=C(C)CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C17H23NO2/c1-3-20-17(19)11-16-9-10-18(12-14(16)2)13-15-7-5-4-6-8-15/h4-8H,3,9-13H2,1-2H3 |
| InChIKey | GMRFKBYVJSVIIG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|