C13H15N3S — CID 112640977
2-(1,3-thiazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-7-amine (PubChem CID 112640977) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-(1,3-thiazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-7-amine.
| Compound Name | 2-(1,3-thiazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-7-amine |
|---|---|
| PubChem CID | 112640977 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-(1,3-thiazol-5-ylmethyl)-3,4-dihydro-1H-isoquinolin-7-amine |
| SMILES | Nc1ccc2c(c1)CN(Cc1cncs1)CC2 |
| InChI | InChI=1S/C13H15N3S/c14-12-2-1-10-3-4-16(7-11(10)5-12)8-13-6-15-9-17-13/h1-2,5-6,9H,3-4,7-8,14H2 |
| InChIKey | HHRUKKWNBIEYFK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|