C13H15N3S — CID 54962658
2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-dihydroisoindol-5-amine (PubChem CID 54962658) has the molecular formula C13H15N3S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-dihydroisoindol-5-amine.
| Compound Name | 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-dihydroisoindol-5-amine |
|---|---|
| PubChem CID | 54962658 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,3-dihydroisoindol-5-amine |
| SMILES | Cc1ncc(CN2Cc3ccc(N)cc3C2)s1 |
| InChI | InChI=1S/C13H15N3S/c1-9-15-5-13(17-9)8-16-6-10-2-3-12(14)4-11(10)7-16/h2-5H,6-8,14H2,1H3 |
| InChIKey | WSPHCLAFFLOODO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|