C16H23Cl3N4OS — CID 119903039
(3-aminophenyl)-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]methanone;trihydrochloride (PubChem CID 119903039) has the molecular formula C16H23Cl3N4OS and a molecular weight of 425.81 g/mol. Its IUPAC name is (3-aminophenyl)-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]methanone;trihydrochloride.
| Compound Name | (3-aminophenyl)-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]methanone;trihydrochloride |
|---|---|
| PubChem CID | 119903039 |
| Molecular Formula | C16H23Cl3N4OS |
| Molecular Weight | 425.81 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | (3-aminophenyl)-[4-[(2-methyl-1,3-thiazol-5-yl)methyl]piperazin-1-yl]methanone;trihydrochloride |
| SMILES | Cc1ncc(CN2CCN(C(=O)c3cccc(N)c3)CC2)s1.Cl.Cl.Cl |
| InChI | InChI=1S/C16H20N4OS.3ClH/c1-12-18-10-15(22-12)11-19-5-7-20(8-6-19)16(21)13-3-2-4-14(17)9-13;;;/h2-4,9-10H,5-8,11,17H2,1H3;3*1H |
| InChIKey | CLZRIEMGGACZSA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|