C15H21Cl2N5O — CID 119887331
(3-aminophenyl)-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]methanone;dihydrochloride (PubChem CID 119887331) has the molecular formula C15H21Cl2N5O and a molecular weight of 358.27 g/mol. Its IUPAC name is (3-aminophenyl)-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]methanone;dihydrochloride.
| Compound Name | (3-aminophenyl)-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119887331 |
| Molecular Formula | C15H21Cl2N5O |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | (3-aminophenyl)-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc(N2CCN(C(=O)c3cccc(N)c3)CC2)cn1 |
| InChI | InChI=1S/C15H19N5O.2ClH/c1-18-11-14(10-17-18)19-5-7-20(8-6-19)15(21)12-3-2-4-13(16)9-12;;/h2-4,9-11H,5-8,16H2,1H3;2*1H |
| InChIKey | JOPPJIZSYVJUPJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|