C12H12N4S — CID 68619298
1-[(2-methyl-1,3-thiazol-5-yl)methyl]indazol-5-amine (PubChem CID 68619298) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]indazol-5-amine.
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]indazol-5-amine |
|---|---|
| PubChem CID | 68619298 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]indazol-5-amine |
| SMILES | Cc1ncc(Cn2ncc3cc(N)ccc32)s1 |
| InChI | InChI=1S/C12H12N4S/c1-8-14-6-11(17-8)7-16-12-3-2-10(13)4-9(12)5-15-16/h2-6H,7,13H2,1H3 |
| InChIKey | KRBIOIUSHRGGGD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|