About 1-hydroxyindazol-5-amine
1-hydroxyindazol-5-amine (PubChem CID 144847821) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 1-hydroxyindazol-5-amine.
Molecular Properties
| Compound Name | 1-hydroxyindazol-5-amine |
| PubChem CID | 144847821 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 1-hydroxyindazol-5-amine |
| SMILES | Nc1ccc2c(cnn2O)c1 |
| InChI | InChI=1S/C7H7N3O/c8-6-1-2-7-5(3-6)4-9-10(7)11/h1-4,11H,8H2 |
| InChIKey | JPNAMAXQZIORJR-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyindazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyindazol-5-amine?
The IUPAC name of 1-hydroxyindazol-5-amine (CID 144847821) is 1-hydroxyindazol-5-amine.
What is the SMILES notation for 1-hydroxyindazol-5-amine?
The canonical SMILES for 1-hydroxyindazol-5-amine is Nc1ccc2c(cnn2O)c1.
What is the InChIKey of 1-hydroxyindazol-5-amine?
The InChIKey is JPNAMAXQZIORJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-6-1-2-7-5(3-6)4-9-10(7)11/h1-4,11H,8H2.
What are the key properties of 1-hydroxyindazol-5-amine?
1-hydroxyindazol-5-amine has a molecular weight of 149.15 g/mol, XLogP of 0.86, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyindazol-5-amine is sourced from PubChem (CID 144847821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).