C9H10N2O3 — CID 101356169
1-hydroxy-5,6-dimethoxyindazole (PubChem CID 101356169) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 1-hydroxy-5,6-dimethoxyindazole.
| Compound Name | 1-hydroxy-5,6-dimethoxyindazole |
|---|---|
| PubChem CID | 101356169 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 1-hydroxy-5,6-dimethoxyindazole |
| SMILES | COc1cc2cnn(O)c2cc1OC |
| InChI | InChI=1S/C9H10N2O3/c1-13-8-3-6-5-10-11(12)7(6)4-9(8)14-2/h3-5,12H,1-2H3 |
| InChIKey | QBVMUEDVPJQNJX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|